C24H39N7O7S — CID 100993151
tert-butyl N-[(3R)-3-(benzylsulfonylamino)-4-[[2-[[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]amino]-2-oxoethyl]amino]-4-oxobutyl]carbamate (PubChem CID 100993151) has the molecular formula C24H39N7O7S and a molecular weight of 569.69 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-(benzylsulfonylamino)-4-[[2-[[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]amino]-2-oxoethyl]amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-(benzylsulfonylamino)-4-[[2-[[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]amino]-2-oxoethyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 100993151 |
| Molecular Formula | C24H39N7O7S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | tert-butyl N-[(3R)-3-(benzylsulfonylamino)-4-[[2-[[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]amino]-2-oxoethyl]amino]-4-oxobutyl]carbamate |
| SMILES | [H]/N=C(\N)N1CCC[C@H](NC(=O)CNC(=O)[C@@H](CCNC(=O)OC(C)(C)C)NS(=O)(=O)Cc2ccccc2)C1O |
| InChI | InChI=1S/C24H39N7O7S/c1-24(2,3)38-23(35)27-12-11-17(30-39(36,37)15-16-8-5-4-6-9-16)20(33)28-14-19(32)29-18-10-7-13-31(21(18)34)22(25)26/h4-6,8-9,17-18,21,30,34H,7,10-15H2,1-3H3,(H3,25,26)(H,27,35)(H,28,33)(H,29,32)/t17-,18+,21?/m1/s1 |
| InChIKey | WNWUKCAMIBLPCW-IZKAZRHKSA-N |
| XLogP | -0.70 |
| TPSA | 216.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|