C20H25N5O4S — CID 100980382
3-(benzylsulfonylamino)-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]benzamide (PubChem CID 100980382) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is 3-(benzylsulfonylamino)-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]benzamide.
| Compound Name | 3-(benzylsulfonylamino)-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 100980382 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3-(benzylsulfonylamino)-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]benzamide |
| SMILES | [H]/N=C(\N)N1CCC[C@H](NC(=O)c2cccc(NS(=O)(=O)Cc3ccccc3)c2)C1O |
| InChI | InChI=1S/C20H25N5O4S/c21-20(22)25-11-5-10-17(19(25)27)23-18(26)15-8-4-9-16(12-15)24-30(28,29)13-14-6-2-1-3-7-14/h1-4,6-9,12,17,19,24,27H,5,10-11,13H2,(H3,21,22)(H,23,26)/t17-,19?/m0/s1 |
| InChIKey | JOVZERHGHUGIKF-KKFHFHRHSA-N |
| XLogP | 1.03 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|