C19H31N9O3 — CID 100980378
3-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]benzamide (PubChem CID 100980378) has the molecular formula C19H31N9O3 and a molecular weight of 433.52 g/mol. Its IUPAC name is 3-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]benzamide.
| Compound Name | 3-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 100980378 |
| Molecular Formula | C19H31N9O3 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 3-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]benzamide |
| SMILES | [H]/N=C(\N)N1CCC[C@H](NC(=O)c2cccc(NC(=O)[C@H](N)CCCN=C(N)N)c2)C1O |
| InChI | InChI=1S/C19H31N9O3/c20-13(6-2-8-25-18(21)22)16(30)26-12-5-1-4-11(10-12)15(29)27-14-7-3-9-28(17(14)31)19(23)24/h1,4-5,10,13-14,17,31H,2-3,6-9,20H2,(H3,23,24)(H,26,30)(H,27,29)(H4,21,22,25)/t13-,14+,17?/m1/s1 |
| InChIKey | JDRCKBOOSWUMGS-LICQEQMYSA-N |
| XLogP | -1.59 |
| TPSA | 221.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|