C24H35N7O9 — CID 67827975
(2S)-2-[[(2S)-2-[[3-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]benzoyl]amino]-3-carboxypropanoyl]-(carboxymethyl)amino]-3-methylbutanoic acid (PubChem CID 67827975) has the molecular formula C24H35N7O9 and a molecular weight of 565.58 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[3-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]benzoyl]amino]-3-carboxypropanoyl]-(carboxymethyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[3-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]benzoyl]amino]-3-carboxypropanoyl]-(carboxymethyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 67827975 |
| Molecular Formula | C24H35N7O9 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[3-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]benzoyl]amino]-3-carboxypropanoyl]-(carboxymethyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)N(CC(=O)O)C(=O)[C@H](CC(=O)O)NC(=O)c1cccc(NC(=O)[C@@H](N)CCCN=C(N)N)c1 |
| InChI | InChI=1S/C24H35N7O9/c1-12(2)19(23(39)40)31(11-18(34)35)22(38)16(10-17(32)33)30-20(36)13-5-3-6-14(9-13)29-21(37)15(25)7-4-8-28-24(26)27/h3,5-6,9,12,15-16,19H,4,7-8,10-11,25H2,1-2H3,(H,29,37)(H,30,36)(H,32,33)(H,34,35)(H,39,40)(H4,26,27,28)/t15-,16-,19-/m0/s1 |
| InChIKey | KFPFGKUGNDJHQI-BXWFABGCSA-N |
| XLogP | -1.40 |
| TPSA | 280.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|