C23H33N7O5 — CID 59904390
(2S)-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]-1-[(2R)-3-hydroxy-2-(2-phenylethylcarbamoylamino)propanoyl]-2,5-dihydropyrrole-2-carboxamide (PubChem CID 59904390) has the molecular formula C23H33N7O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is (2S)-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]-1-[(2R)-3-hydroxy-2-(2-phenylethylcarbamoylamino)propanoyl]-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | (2S)-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]-1-[(2R)-3-hydroxy-2-(2-phenylethylcarbamoylamino)propanoyl]-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59904390 |
| Molecular Formula | C23H33N7O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (2S)-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]-1-[(2R)-3-hydroxy-2-(2-phenylethylcarbamoylamino)propanoyl]-2,5-dihydropyrrole-2-carboxamide |
| SMILES | [H]/N=C(\N)N1CCC[C@H](NC(=O)[C@@H]2C=CCN2C(=O)[C@@H](CO)NC(=O)NCCc2ccccc2)C1O |
| InChI | InChI=1S/C23H33N7O5/c24-22(25)30-13-4-8-16(20(30)33)27-19(32)18-9-5-12-29(18)21(34)17(14-31)28-23(35)26-11-10-15-6-2-1-3-7-15/h1-3,5-7,9,16-18,20,31,33H,4,8,10-14H2,(H3,24,25)(H,27,32)(H2,26,28,35)/t16-,17+,18-,20?/m0/s1 |
| InChIKey | BEQNQARFGKADLF-JTUYAUNFSA-N |
| XLogP | -1.55 |
| TPSA | 184.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|