C18H18N2O2S — CID 16671629
(2S)-N-(2-phenylethyl)-1-(thiophene-2-carbonyl)-2,5-dihydropyrrole-2-carboxamide (PubChem CID 16671629) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is (2S)-N-(2-phenylethyl)-1-(thiophene-2-carbonyl)-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | (2S)-N-(2-phenylethyl)-1-(thiophene-2-carbonyl)-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 16671629 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (2S)-N-(2-phenylethyl)-1-(thiophene-2-carbonyl)-2,5-dihydropyrrole-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1)[C@@H]1C=CCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C18H18N2O2S/c21-17(19-11-10-14-6-2-1-3-7-14)15-8-4-12-20(15)18(22)16-9-5-13-23-16/h1-9,13,15H,10-12H2,(H,19,21)/t15-/m0/s1 |
| InChIKey | PZGDBCGHRKUPET-HNNXBMFYSA-N |
| XLogP | 2.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|