C41H38N2O3S2 — CID 139647079
5-[[4-[2-(2-phenylthiomorpholin-4-yl)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione (PubChem CID 139647079) has the molecular formula C41H38N2O3S2 and a molecular weight of 670.90 g/mol. Its IUPAC name is 5-[[4-[2-(2-phenylthiomorpholin-4-yl)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(2-phenylthiomorpholin-4-yl)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139647079 |
| Molecular Formula | C41H38N2O3S2 |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.23 |
| IUPAC Name | 5-[[4-[2-(2-phenylthiomorpholin-4-yl)ethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(Cc2ccc(OCCN3CCSC(c4ccccc4)C3)cc2)C(=O)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H38N2O3S2/c44-39-37(29-31-21-23-36(24-22-31)46-27-25-42-26-28-47-38(30-42)32-13-5-1-6-14-32)48-40(45)43(39)41(33-15-7-2-8-16-33,34-17-9-3-10-18-34)35-19-11-4-12-20-35/h1-24,37-38H,25-30H2 |
| InChIKey | YKKRCIRBLUMVOY-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|