C14H16ClNO4 — CID 139647185
methyl (2R)-2-[(2R)-2-(3-chlorophenyl)-5-oxomorpholin-4-yl]propanoate (PubChem CID 139647185) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is methyl (2R)-2-[(2R)-2-(3-chlorophenyl)-5-oxomorpholin-4-yl]propanoate.
| Compound Name | methyl (2R)-2-[(2R)-2-(3-chlorophenyl)-5-oxomorpholin-4-yl]propanoate |
|---|---|
| PubChem CID | 139647185 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | methyl (2R)-2-[(2R)-2-(3-chlorophenyl)-5-oxomorpholin-4-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)N1C[C@@H](c2cccc(Cl)c2)OCC1=O |
| InChI | InChI=1S/C14H16ClNO4/c1-9(14(18)19-2)16-7-12(20-8-13(16)17)10-4-3-5-11(15)6-10/h3-6,9,12H,7-8H2,1-2H3/t9-,12+/m1/s1 |
| InChIKey | RNRLMWFLWVTLNS-SKDRFNHKSA-N |
| XLogP | 1.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |