C18H18ClNO4 — CID 67823889
(5R)-5-(3-chlorophenyl)-3-[(2S)-1-(3,4-dihydroxyphenyl)propan-2-yl]-1,3-oxazolidin-2-one (PubChem CID 67823889) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is (5R)-5-(3-chlorophenyl)-3-[(2S)-1-(3,4-dihydroxyphenyl)propan-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(3-chlorophenyl)-3-[(2S)-1-(3,4-dihydroxyphenyl)propan-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67823889 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (5R)-5-(3-chlorophenyl)-3-[(2S)-1-(3,4-dihydroxyphenyl)propan-2-yl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](Cc1ccc(O)c(O)c1)N1C[C@@H](c2cccc(Cl)c2)OC1=O |
| InChI | InChI=1S/C18H18ClNO4/c1-11(7-12-5-6-15(21)16(22)8-12)20-10-17(24-18(20)23)13-3-2-4-14(19)9-13/h2-6,8-9,11,17,21-22H,7,10H2,1H3/t11-,17-/m0/s1 |
| InChIKey | RXPMTFOPTJYGEB-GTNSWQLSSA-N |
| XLogP | 3.88 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|