About (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate
(2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate (PubChem CID 139648837) has the molecular formula C22H32O3
and a molecular weight of 344.50 g/mol. Its IUPAC name is (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate.
Molecular Properties
| Compound Name | (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate |
| PubChem CID | 139648837 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate |
| SMILES | CCCCCCCCCc1ccccc1OC(=O)C(C)=CCC1CO1 |
| InChI | InChI=1S/C22H32O3/c1-3-4-5-6-7-8-9-12-19-13-10-11-14-21(19)25-22(23)18(2)15-16-20-17-24-20/h10-11,13-15,20H,3-9,12,16-17H2,1-2H3 |
| InChIKey | BFIPZWSKGCJFHG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate?
The IUPAC name of (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate (CID 139648837) is (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate.
What is the SMILES notation for (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate?
The canonical SMILES for (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate is CCCCCCCCCc1ccccc1OC(=O)C(C)=CCC1CO1.
What is the InChIKey of (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate?
The InChIKey is BFIPZWSKGCJFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O3/c1-3-4-5-6-7-8-9-12-19-13-10-11-14-21(19)25-22(23)18(2)15-16-20-17-24-20/h10-11,13-15,20H,3-9,12,16-17H2,1-2H3.
What are the key properties of (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate?
(2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate has a molecular weight of 344.50 g/mol, XLogP of 5.62, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nonylphenyl) 2-methyl-4-(oxiran-2-yl)but-2-enoate is sourced from PubChem (CID 139648837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).