C22H40Na2O7S — CID 139649859
disodium;2,2-di(nonan-5-yl)-3-sulfobutanedioate (PubChem CID 139649859) has the molecular formula C22H40Na2O7S and a molecular weight of 494.60 g/mol. Its IUPAC name is disodium;2,2-di(nonan-5-yl)-3-sulfobutanedioate.
| Compound Name | disodium;2,2-di(nonan-5-yl)-3-sulfobutanedioate |
|---|---|
| PubChem CID | 139649859 |
| Molecular Formula | C22H40Na2O7S |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | disodium;2,2-di(nonan-5-yl)-3-sulfobutanedioate |
| SMILES | CCCCC(CCCC)C(C(=O)[O-])(C(CCCC)CCCC)C(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C22H42O7S.2Na/c1-5-9-13-17(14-10-6-2)22(21(25)26,19(20(23)24)30(27,28)29)18(15-11-7-3)16-12-8-4;;/h17-19H,5-16H2,1-4H3,(H,23,24)(H,25,26)(H,27,28,29);;/q;2*+1/p-2 |
| InChIKey | GYSZJXMHKPFNCL-UHFFFAOYSA-L |
| XLogP | -3.27 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|