C16H28Na2O7S — CID 87113414
disodium;2,2-dihexyl-3-sulfobutanedioate (PubChem CID 87113414) has the molecular formula C16H28Na2O7S and a molecular weight of 410.44 g/mol. Its IUPAC name is disodium;2,2-dihexyl-3-sulfobutanedioate.
| Compound Name | disodium;2,2-dihexyl-3-sulfobutanedioate |
|---|---|
| PubChem CID | 87113414 |
| Molecular Formula | C16H28Na2O7S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | disodium;2,2-dihexyl-3-sulfobutanedioate |
| SMILES | CCCCCCC(CCCCCC)(C(=O)[O-])C(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C16H30O7S.2Na/c1-3-5-7-9-11-16(15(19)20,12-10-8-6-4-2)13(14(17)18)24(21,22)23;;/h13H,3-12H2,1-2H3,(H,17,18)(H,19,20)(H,21,22,23);;/q;2*+1/p-2 |
| InChIKey | RZMWTGFSAMRLQH-UHFFFAOYSA-L |
| XLogP | -5.32 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | -5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|