C30H64N2O9S — CID 140573022
2,2-bis(6-methylheptyl)-3-sulfobutanedioate;bis(2-hydroxyethyl(trimethyl)azanium) (PubChem CID 140573022) has the molecular formula C30H64N2O9S and a molecular weight of 628.91 g/mol. Its IUPAC name is 2,2-bis(6-methylheptyl)-3-sulfobutanedioate;bis(2-hydroxyethyl(trimethyl)azanium).
| Compound Name | 2,2-bis(6-methylheptyl)-3-sulfobutanedioate;bis(2-hydroxyethyl(trimethyl)azanium) |
|---|---|
| PubChem CID | 140573022 |
| Molecular Formula | C30H64N2O9S |
| Molecular Weight | 628.91 g/mol |
| Exact Mass | 628.43 |
| IUPAC Name | 2,2-bis(6-methylheptyl)-3-sulfobutanedioate;bis(2-hydroxyethyl(trimethyl)azanium) |
| SMILES | CC(C)CCCCCC(CCCCCC(C)C)(C(=O)[O-])C(C(=O)[O-])S(=O)(=O)O.C[N+](C)(C)CCO.C[N+](C)(C)CCO |
| InChI | InChI=1S/C20H38O7S.2C5H14NO/c1-15(2)11-7-5-9-13-20(19(23)24,14-10-6-8-12-16(3)4)17(18(21)22)28(25,26)27;2*1-6(2,3)4-5-7/h15-17H,5-14H2,1-4H3,(H,21,22)(H,23,24)(H,25,26,27);2*7H,4-5H2,1-3H3/q;2*+1/p-2 |
| InChIKey | GFWKCLKXHRXWLT-UHFFFAOYSA-L |
| XLogP | 1.31 |
| TPSA | 175.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.91 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|