C12H20K2O7S — CID 141499570
dipotassium;2,2-bis(2-methylpropyl)-3-sulfobutanedioate (PubChem CID 141499570) has the molecular formula C12H20K2O7S and a molecular weight of 386.55 g/mol. Its IUPAC name is dipotassium;2,2-bis(2-methylpropyl)-3-sulfobutanedioate.
| Compound Name | dipotassium;2,2-bis(2-methylpropyl)-3-sulfobutanedioate |
|---|---|
| PubChem CID | 141499570 |
| Molecular Formula | C12H20K2O7S |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | dipotassium;2,2-bis(2-methylpropyl)-3-sulfobutanedioate |
| SMILES | CC(C)CC(CC(C)C)(C(=O)[O-])C(C(=O)[O-])S(=O)(=O)O.[K+].[K+] |
| InChI | InChI=1S/C12H22O7S.2K/c1-7(2)5-12(11(15)16,6-8(3)4)9(10(13)14)20(17,18)19;;/h7-9H,5-6H2,1-4H3,(H,13,14)(H,15,16)(H,17,18,19);;/q;2*+1/p-2 |
| InChIKey | GFQXVGQAFQGXCM-UHFFFAOYSA-L |
| XLogP | -7.17 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | -7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|