C22H40K2O7S — CID 141499550
dipotassium;2,2-bis(7-methyloctyl)-3-sulfobutanedioate (PubChem CID 141499550) has the molecular formula C22H40K2O7S and a molecular weight of 526.82 g/mol. Its IUPAC name is dipotassium;2,2-bis(7-methyloctyl)-3-sulfobutanedioate.
| Compound Name | dipotassium;2,2-bis(7-methyloctyl)-3-sulfobutanedioate |
|---|---|
| PubChem CID | 141499550 |
| Molecular Formula | C22H40K2O7S |
| Molecular Weight | 526.82 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | dipotassium;2,2-bis(7-methyloctyl)-3-sulfobutanedioate |
| SMILES | CC(C)CCCCCCC(CCCCCCC(C)C)(C(=O)[O-])C(C(=O)[O-])S(=O)(=O)O.[K+].[K+] |
| InChI | InChI=1S/C22H42O7S.2K/c1-17(2)13-9-5-7-11-15-22(21(25)26,19(20(23)24)30(27,28)29)16-12-8-6-10-14-18(3)4;;/h17-19H,5-16H2,1-4H3,(H,23,24)(H,25,26)(H,27,28,29);;/q;2*+1/p-2 |
| InChIKey | RUXNODUMZXSXJW-UHFFFAOYSA-L |
| XLogP | -3.27 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.82 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|