C20H40N2O5S — CID 151900782
1-amino-3-carbamoyl-3-octyl-1-oxoundecane-2-sulfonic acid (PubChem CID 151900782) has the molecular formula C20H40N2O5S and a molecular weight of 420.62 g/mol. Its IUPAC name is 1-amino-3-carbamoyl-3-octyl-1-oxoundecane-2-sulfonic acid.
| Compound Name | 1-amino-3-carbamoyl-3-octyl-1-oxoundecane-2-sulfonic acid |
|---|---|
| PubChem CID | 151900782 |
| Molecular Formula | C20H40N2O5S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 1-amino-3-carbamoyl-3-octyl-1-oxoundecane-2-sulfonic acid |
| SMILES | CCCCCCCCC(CCCCCCCC)(C(N)=O)C(C(N)=O)S(=O)(=O)O |
| InChI | InChI=1S/C20H40N2O5S/c1-3-5-7-9-11-13-15-20(19(22)24,16-14-12-10-8-6-4-2)17(18(21)23)28(25,26)27/h17H,3-16H2,1-2H3,(H2,21,23)(H2,22,24)(H,25,26,27) |
| InChIKey | SSSJHJCFGQHWAT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|