C12H8N4O4 — CID 139652017
6-[(2,7-dioxo-3-azatricyclo[4.1.0.01,3]heptan-6-yl)diazenyl]-3-azatricyclo[4.1.0.01,3]heptane-2,7-dione (PubChem CID 139652017) has the molecular formula C12H8N4O4 and a molecular weight of 272.22 g/mol. Its IUPAC name is 6-[(2,7-dioxo-3-azatricyclo[4.1.0.01,3]heptan-6-yl)diazenyl]-3-azatricyclo[4.1.0.01,3]heptane-2,7-dione.
| Compound Name | 6-[(2,7-dioxo-3-azatricyclo[4.1.0.01,3]heptan-6-yl)diazenyl]-3-azatricyclo[4.1.0.01,3]heptane-2,7-dione |
|---|---|
| PubChem CID | 139652017 |
| Molecular Formula | C12H8N4O4 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 6-[(2,7-dioxo-3-azatricyclo[4.1.0.01,3]heptan-6-yl)diazenyl]-3-azatricyclo[4.1.0.01,3]heptane-2,7-dione |
| SMILES | O=C1N2CCC3(/N=N/C45CCN6C(=O)C64C5=O)C(=O)C123 |
| InChI | InChI=1S/C12H8N4O4/c17-5-9(1-3-15-7(19)11(5,9)15)13-14-10-2-4-16-8(20)12(10,16)6(10)18/h1-4H2/b14-13+ |
| InChIKey | JGSNPMDFYWBVCI-BUHFOSPRSA-N |
| XLogP | -1.95 |
| TPSA | 99.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|