C31H33IN2S — CID 139653895
4-[2-[5,5-dimethyl-3-[(3-methylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]cyclohexen-1-yl]ethenyl]-N,N-dimethylaniline iodide (PubChem CID 139653895) has the molecular formula C31H33IN2S and a molecular weight of 592.59 g/mol. Its IUPAC name is 4-[2-[5,5-dimethyl-3-[(3-methylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]cyclohexen-1-yl]ethenyl]-N,N-dimethylaniline iodide.
| Compound Name | 4-[2-[5,5-dimethyl-3-[(3-methylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]cyclohexen-1-yl]ethenyl]-N,N-dimethylaniline iodide |
|---|---|
| PubChem CID | 139653895 |
| Molecular Formula | C31H33IN2S |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 4-[2-[5,5-dimethyl-3-[(3-methylbenzo[g][1,3]benzothiazol-3-ium-2-yl)methylidene]cyclohexen-1-yl]ethenyl]-N,N-dimethylaniline iodide |
| SMILES | CN(C)c1ccc(C=CC2=CC(=Cc3sc4c5ccccc5ccc4[n+]3C)CC(C)(C)C2)cc1.[I-] |
| InChI | InChI=1S/C31H33N2S.HI/c1-31(2)20-23(11-10-22-12-15-26(16-13-22)32(3)4)18-24(21-31)19-29-33(5)28-17-14-25-8-6-7-9-27(25)30(28)34-29;/h6-19H,20-21H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | GAUBZXJXTOJKKC-UHFFFAOYSA-M |
| XLogP | 4.79 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|