C11H22O4S — CID 139654465
(2R,3S,4S)-2,3,4-trihydroxy-5-(4-methylpentan-2-ylsulfanyl)pentanal (PubChem CID 139654465) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is (2R,3S,4S)-2,3,4-trihydroxy-5-(4-methylpentan-2-ylsulfanyl)pentanal.
| Compound Name | (2R,3S,4S)-2,3,4-trihydroxy-5-(4-methylpentan-2-ylsulfanyl)pentanal |
|---|---|
| PubChem CID | 139654465 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (2R,3S,4S)-2,3,4-trihydroxy-5-(4-methylpentan-2-ylsulfanyl)pentanal |
| SMILES | CC(C)CC(C)SC[C@@H](O)[C@@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C11H22O4S/c1-7(2)4-8(3)16-6-10(14)11(15)9(13)5-12/h5,7-11,13-15H,4,6H2,1-3H3/t8?,9-,10+,11-/m0/s1 |
| InChIKey | GRHSUTFUQODXCD-GYIHNLGQSA-N |
| XLogP | 0.44 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|