C8H14O5S — CID 135056453
(3S,4S)-3,4-dihydroxy-5-(2-hydroxy-3-oxopropyl)sulfanylpentanal (PubChem CID 135056453) has the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. Its IUPAC name is (3S,4S)-3,4-dihydroxy-5-(2-hydroxy-3-oxopropyl)sulfanylpentanal.
| Compound Name | (3S,4S)-3,4-dihydroxy-5-(2-hydroxy-3-oxopropyl)sulfanylpentanal |
|---|---|
| PubChem CID | 135056453 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (3S,4S)-3,4-dihydroxy-5-(2-hydroxy-3-oxopropyl)sulfanylpentanal |
| SMILES | O=CC[C@H](O)[C@H](O)CSCC(O)C=O |
| InChI | InChI=1S/C8H14O5S/c9-2-1-7(12)8(13)5-14-4-6(11)3-10/h2-3,6-8,11-13H,1,4-5H2/t6?,7-,8+/m0/s1 |
| InChIKey | PFAAAZSRUXNEBR-ZHFSPANRSA-N |
| XLogP | -1.41 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|