C10H20O4S — CID 139654474
(2R,3S,4S)-2,3,4-trihydroxy-5-(2-methylbutylsulfanyl)pentanal (PubChem CID 139654474) has the molecular formula C10H20O4S and a molecular weight of 236.33 g/mol. Its IUPAC name is (2R,3S,4S)-2,3,4-trihydroxy-5-(2-methylbutylsulfanyl)pentanal.
| Compound Name | (2R,3S,4S)-2,3,4-trihydroxy-5-(2-methylbutylsulfanyl)pentanal |
|---|---|
| PubChem CID | 139654474 |
| Molecular Formula | C10H20O4S |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (2R,3S,4S)-2,3,4-trihydroxy-5-(2-methylbutylsulfanyl)pentanal |
| SMILES | CCC(C)CSC[C@@H](O)[C@@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C10H20O4S/c1-3-7(2)5-15-6-9(13)10(14)8(12)4-11/h4,7-10,12-14H,3,5-6H2,1-2H3/t7?,8-,9+,10-/m0/s1 |
| InChIKey | RXQBJPOFTFVCQS-UPBARMNASA-N |
| XLogP | 0.05 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|