About dichlorozirconium(2+);diethylazanide;2-methylpropylazanide
dichlorozirconium(2+);diethylazanide;2-methylpropylazanide (PubChem CID 139658376) has the molecular formula C8H20Cl2N2Zr
and a molecular weight of 306.39 g/mol. Its IUPAC name is dichlorozirconium(2+);diethylazanide;2-methylpropylazanide.
Molecular Properties
| Compound Name | dichlorozirconium(2+);diethylazanide;2-methylpropylazanide |
| PubChem CID | 139658376 |
| Molecular Formula | C8H20Cl2N2Zr |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | dichlorozirconium(2+);diethylazanide;2-methylpropylazanide |
| SMILES | CC(C)C[NH-].CC[N-]CC.Cl[Zr+2]Cl |
| InChI | InChI=1S/2C4H10N.2ClH.Zr/c1-4(2)3-5;1-3-5-4-2;;;/h4-5H,3H2,1-2H3;3-4H2,1-2H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | XJRCRWYNXVNMBW-UHFFFAOYSA-L |
| XLogP | 4.47 |
| TPSA | 37.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichlorozirconium(2+);diethylazanide;2-methylpropylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium(2+);diethylazanide;2-methylpropylazanide?
The IUPAC name of dichlorozirconium(2+);diethylazanide;2-methylpropylazanide (CID 139658376) is dichlorozirconium(2+);diethylazanide;2-methylpropylazanide.
What is the SMILES notation for dichlorozirconium(2+);diethylazanide;2-methylpropylazanide?
The canonical SMILES for dichlorozirconium(2+);diethylazanide;2-methylpropylazanide is CC(C)C[NH-].CC[N-]CC.Cl[Zr+2]Cl.
What is the InChIKey of dichlorozirconium(2+);diethylazanide;2-methylpropylazanide?
The InChIKey is XJRCRWYNXVNMBW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H10N.2ClH.Zr/c1-4(2)3-5;1-3-5-4-2;;;/h4-5H,3H2,1-2H3;3-4H2,1-2H3;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of dichlorozirconium(2+);diethylazanide;2-methylpropylazanide?
dichlorozirconium(2+);diethylazanide;2-methylpropylazanide has a molecular weight of 306.39 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium(2+);diethylazanide;2-methylpropylazanide is sourced from PubChem (CID 139658376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).