C24H42O8 — CID 139659020
(2R,3R)-2,3-di(decanoyl)-2,3-dihydroxybutanedioic acid (PubChem CID 139659020) has the molecular formula C24H42O8 and a molecular weight of 458.59 g/mol. Its IUPAC name is (2R,3R)-2,3-di(decanoyl)-2,3-dihydroxybutanedioic acid.
| Compound Name | (2R,3R)-2,3-di(decanoyl)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 139659020 |
| Molecular Formula | C24H42O8 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | (2R,3R)-2,3-di(decanoyl)-2,3-dihydroxybutanedioic acid |
| SMILES | CCCCCCCCCC(=O)[C@@](O)(C(=O)O)[C@](O)(C(=O)O)C(=O)CCCCCCCCC |
| InChI | InChI=1S/C24H42O8/c1-3-5-7-9-11-13-15-17-19(25)23(31,21(27)28)24(32,22(29)30)20(26)18-16-14-12-10-8-6-4-2/h31-32H,3-18H2,1-2H3,(H,27,28)(H,29,30)/t23-,24-/m1/s1 |
| InChIKey | CVBGOTFNEZRFAQ-DNQXCXABSA-N |
| XLogP | 4.04 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|