C24H44O6 — CID 87496374
8-heptanoyl-8,9-dihydroxy-9-(hydroxymethyl)hexadecane-7,10-dione (PubChem CID 87496374) has the molecular formula C24H44O6 and a molecular weight of 428.61 g/mol. Its IUPAC name is 8-heptanoyl-8,9-dihydroxy-9-(hydroxymethyl)hexadecane-7,10-dione.
| Compound Name | 8-heptanoyl-8,9-dihydroxy-9-(hydroxymethyl)hexadecane-7,10-dione |
|---|---|
| PubChem CID | 87496374 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 8-heptanoyl-8,9-dihydroxy-9-(hydroxymethyl)hexadecane-7,10-dione |
| SMILES | CCCCCCC(=O)C(O)(CO)C(O)(C(=O)CCCCCC)C(=O)CCCCCC |
| InChI | InChI=1S/C24H44O6/c1-4-7-10-13-16-20(26)23(29,19-25)24(30,21(27)17-14-11-8-5-2)22(28)18-15-12-9-6-3/h25,29-30H,4-19H2,1-3H3 |
| InChIKey | CEXOCNRKCNUYFG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|