C33H62O6 — CID 87559489
11-decanoyl-11,12-dihydroxy-12-(hydroxymethyl)docosane-10,13-dione (PubChem CID 87559489) has the molecular formula C33H62O6 and a molecular weight of 554.85 g/mol. Its IUPAC name is 11-decanoyl-11,12-dihydroxy-12-(hydroxymethyl)docosane-10,13-dione.
| Compound Name | 11-decanoyl-11,12-dihydroxy-12-(hydroxymethyl)docosane-10,13-dione |
|---|---|
| PubChem CID | 87559489 |
| Molecular Formula | C33H62O6 |
| Molecular Weight | 554.85 g/mol |
| Exact Mass | 554.45 |
| IUPAC Name | 11-decanoyl-11,12-dihydroxy-12-(hydroxymethyl)docosane-10,13-dione |
| SMILES | CCCCCCCCCC(=O)C(O)(CO)C(O)(C(=O)CCCCCCCCC)C(=O)CCCCCCCCC |
| InChI | InChI=1S/C33H62O6/c1-4-7-10-13-16-19-22-25-29(35)32(38,28-34)33(39,30(36)26-23-20-17-14-11-8-5-2)31(37)27-24-21-18-15-12-9-6-3/h34,38-39H,4-28H2,1-3H3 |
| InChIKey | UGGPTGOQJZQQOJ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.85 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|