C23H45O5P — CID 174201992
11,12-dihydroxy-11-(hydroxymethyl)-12-phosphanyldocosane-10,13-dione (PubChem CID 174201992) has the molecular formula C23H45O5P and a molecular weight of 432.58 g/mol. Its IUPAC name is 11,12-dihydroxy-11-(hydroxymethyl)-12-phosphanyldocosane-10,13-dione.
| Compound Name | 11,12-dihydroxy-11-(hydroxymethyl)-12-phosphanyldocosane-10,13-dione |
|---|---|
| PubChem CID | 174201992 |
| Molecular Formula | C23H45O5P |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 11,12-dihydroxy-11-(hydroxymethyl)-12-phosphanyldocosane-10,13-dione |
| SMILES | CCCCCCCCCC(=O)C(O)(P)C(O)(CO)C(=O)CCCCCCCCC |
| InChI | InChI=1S/C23H45O5P/c1-3-5-7-9-11-13-15-17-20(25)22(27,19-24)23(28,29)21(26)18-16-14-12-10-8-6-4-2/h24,27-28H,3-19,29H2,1-2H3 |
| InChIKey | XAUJDZWZYZYBBP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|