C26H49O3P — CID 88771864
9-octanoyl-9-(phosphanylmethyl)heptadecane-8,10-dione (PubChem CID 88771864) has the molecular formula C26H49O3P and a molecular weight of 440.65 g/mol. Its IUPAC name is 9-octanoyl-9-(phosphanylmethyl)heptadecane-8,10-dione.
| Compound Name | 9-octanoyl-9-(phosphanylmethyl)heptadecane-8,10-dione |
|---|---|
| PubChem CID | 88771864 |
| Molecular Formula | C26H49O3P |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | 9-octanoyl-9-(phosphanylmethyl)heptadecane-8,10-dione |
| SMILES | CCCCCCCC(=O)C(CP)(C(=O)CCCCCCC)C(=O)CCCCCCC |
| InChI | InChI=1S/C26H49O3P/c1-4-7-10-13-16-19-23(27)26(22-30,24(28)20-17-14-11-8-5-2)25(29)21-18-15-12-9-6-3/h4-22,30H2,1-3H3 |
| InChIKey | DPMBAANVTWPABU-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|