C41H76O9 — CID 175531608
[2,3,4-trihydroxy-4-(hydroxymethyl)-2,3-di(nonanoyl)-5-oxotridecyl] nonanoate (PubChem CID 175531608) has the molecular formula C41H76O9 and a molecular weight of 713.05 g/mol. Its IUPAC name is [2,3,4-trihydroxy-4-(hydroxymethyl)-2,3-di(nonanoyl)-5-oxotridecyl] nonanoate.
| Compound Name | [2,3,4-trihydroxy-4-(hydroxymethyl)-2,3-di(nonanoyl)-5-oxotridecyl] nonanoate |
|---|---|
| PubChem CID | 175531608 |
| Molecular Formula | C41H76O9 |
| Molecular Weight | 713.05 g/mol |
| Exact Mass | 712.55 |
| IUPAC Name | [2,3,4-trihydroxy-4-(hydroxymethyl)-2,3-di(nonanoyl)-5-oxotridecyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OCC(O)(C(=O)CCCCCCCC)C(O)(C(=O)CCCCCCCC)C(O)(CO)C(=O)CCCCCCCC |
| InChI | InChI=1S/C41H76O9/c1-5-9-13-17-21-25-29-35(43)39(47,33-42)41(49,37(45)31-27-23-19-15-11-7-3)40(48,36(44)30-26-22-18-14-10-6-2)34-50-38(46)32-28-24-20-16-12-8-4/h42,47-49H,5-34H2,1-4H3 |
| InChIKey | IMOQKRGFRANCPD-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.05 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|