C42H78O10 — CID 166527972
[(2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)-2,3-di(nonanoyl)-6-oxotetradecyl] nonanoate (PubChem CID 166527972) has the molecular formula C42H78O10 and a molecular weight of 743.08 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)-2,3-di(nonanoyl)-6-oxotetradecyl] nonanoate.
| Compound Name | [(2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)-2,3-di(nonanoyl)-6-oxotetradecyl] nonanoate |
|---|---|
| PubChem CID | 166527972 |
| Molecular Formula | C42H78O10 |
| Molecular Weight | 743.08 g/mol |
| Exact Mass | 742.56 |
| IUPAC Name | [(2R,3S,4R,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)-2,3-di(nonanoyl)-6-oxotetradecyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC[C@](O)(C(=O)CCCCCCCC)[C@](O)(C(=O)CCCCCCCC)[C@H](O)[C@@](O)(CO)C(=O)CCCCCCCC |
| InChI | InChI=1S/C42H78O10/c1-5-9-13-17-21-25-29-35(44)40(49,33-43)39(48)42(51,37(46)31-27-23-19-15-11-7-3)41(50,36(45)30-26-22-18-14-10-6-2)34-52-38(47)32-28-24-20-16-12-8-4/h39,43,48-51H,5-34H2,1-4H3/t39-,40-,41+,42+/m1/s1 |
| InChIKey | GUVXDHHSZHCHNH-GLGKVNTQSA-N |
| XLogP | 7.79 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.08 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|