C33H62O9 — CID 166527960
[(2R,3R,4S,5S)-1,3,4,5-tetrahydroxy-5-(hydroxymethyl)-4-nonanoyl-6-oxotetradecan-2-yl] nonanoate (PubChem CID 166527960) has the molecular formula C33H62O9 and a molecular weight of 602.85 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-1,3,4,5-tetrahydroxy-5-(hydroxymethyl)-4-nonanoyl-6-oxotetradecan-2-yl] nonanoate.
| Compound Name | [(2R,3R,4S,5S)-1,3,4,5-tetrahydroxy-5-(hydroxymethyl)-4-nonanoyl-6-oxotetradecan-2-yl] nonanoate |
|---|---|
| PubChem CID | 166527960 |
| Molecular Formula | C33H62O9 |
| Molecular Weight | 602.85 g/mol |
| Exact Mass | 602.44 |
| IUPAC Name | [(2R,3R,4S,5S)-1,3,4,5-tetrahydroxy-5-(hydroxymethyl)-4-nonanoyl-6-oxotetradecan-2-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC(CO)[C@@H](O)[C@@](O)(C(=O)CCCCCCCC)[C@@](O)(CO)C(=O)CCCCCCCC |
| InChI | InChI=1S/C33H62O9/c1-4-7-10-13-16-19-22-28(36)32(40,26-35)33(41,29(37)23-20-17-14-11-8-5-2)31(39)27(25-34)42-30(38)24-21-18-15-12-9-6-3/h27,31,34-35,39-41H,4-26H2,1-3H3/t27?,31-,32-,33+/m1/s1 |
| InChIKey | NJKUWAZAPNCXGJ-KMISIBDWSA-N |
| XLogP | 5.10 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.85 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|