C42H78O10 — CID 175531607
[2,3,4,5,6-pentahydroxy-2,3-di(nonanoyl)-7-oxopentadecyl] nonanoate (PubChem CID 175531607) has the molecular formula C42H78O10 and a molecular weight of 743.08 g/mol. Its IUPAC name is [2,3,4,5,6-pentahydroxy-2,3-di(nonanoyl)-7-oxopentadecyl] nonanoate.
| Compound Name | [2,3,4,5,6-pentahydroxy-2,3-di(nonanoyl)-7-oxopentadecyl] nonanoate |
|---|---|
| PubChem CID | 175531607 |
| Molecular Formula | C42H78O10 |
| Molecular Weight | 743.08 g/mol |
| Exact Mass | 742.56 |
| IUPAC Name | [2,3,4,5,6-pentahydroxy-2,3-di(nonanoyl)-7-oxopentadecyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OCC(O)(C(=O)CCCCCCCC)C(O)(C(=O)CCCCCCCC)C(O)C(O)C(O)C(=O)CCCCCCCC |
| InChI | InChI=1S/C42H78O10/c1-5-9-13-17-21-25-29-34(43)38(47)39(48)40(49)42(51,36(45)31-27-23-19-15-11-7-3)41(50,35(44)30-26-22-18-14-10-6-2)33-52-37(46)32-28-24-20-16-12-8-4/h38-40,47-51H,5-33H2,1-4H3 |
| InChIKey | ZBLOHKIWIHOOPF-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.08 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|