C14H18N4O2 — CID 139659464
4,8-dimethoxy-2-piperazin-1-ylquinazoline (PubChem CID 139659464) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4,8-dimethoxy-2-piperazin-1-ylquinazoline.
| Compound Name | 4,8-dimethoxy-2-piperazin-1-ylquinazoline |
|---|---|
| PubChem CID | 139659464 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4,8-dimethoxy-2-piperazin-1-ylquinazoline |
| SMILES | COc1nc(N2CCNCC2)nc2c(OC)cccc12 |
| InChI | InChI=1S/C14H18N4O2/c1-19-11-5-3-4-10-12(11)16-14(17-13(10)20-2)18-8-6-15-7-9-18/h3-5,15H,6-9H2,1-2H3 |
| InChIKey | BPFIILMLDWQPIH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |