C24H42O2 — CID 139659711
ethyl 4-[(E)-4-(4-pentylcyclohexyl)but-1-enyl]cyclohexane-1-carboxylate (PubChem CID 139659711) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is ethyl 4-[(E)-4-(4-pentylcyclohexyl)but-1-enyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[(E)-4-(4-pentylcyclohexyl)but-1-enyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139659711 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | ethyl 4-[(E)-4-(4-pentylcyclohexyl)but-1-enyl]cyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(CC/C=C/C2CCC(C(=O)OCC)CC2)CC1 |
| InChI | InChI=1S/C24H42O2/c1-3-5-6-9-20-12-14-21(15-13-20)10-7-8-11-22-16-18-23(19-17-22)24(25)26-4-2/h8,11,20-23H,3-7,9-10,12-19H2,1-2H3/b11-8+ |
| InChIKey | UIWBXFDZHXSHRA-DHZHZOJOSA-N |
| XLogP | 7.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|