C11H18O2 — CID 139660014
6,6-bis(methoxymethyl)bicyclo[2.2.1]hept-1-ene (PubChem CID 139660014) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 6,6-bis(methoxymethyl)bicyclo[2.2.1]hept-1-ene.
| Compound Name | 6,6-bis(methoxymethyl)bicyclo[2.2.1]hept-1-ene |
|---|---|
| PubChem CID | 139660014 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 6,6-bis(methoxymethyl)bicyclo[2.2.1]hept-1-ene |
| SMILES | COCC1(COC)CC2CC=C1C2 |
| InChI | InChI=1S/C11H18O2/c1-12-7-11(8-13-2)6-9-3-4-10(11)5-9/h4,9H,3,5-8H2,1-2H3 |
| InChIKey | QXEAPIZZTGEUBK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|