C21H34O4 — CID 134999317
2,2,7,7-tetrakis(methoxymethyl)-3a-methyl-3,4,6,8-tetrahydro-1H-as-indacene (PubChem CID 134999317) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is 2,2,7,7-tetrakis(methoxymethyl)-3a-methyl-3,4,6,8-tetrahydro-1H-as-indacene.
| Compound Name | 2,2,7,7-tetrakis(methoxymethyl)-3a-methyl-3,4,6,8-tetrahydro-1H-as-indacene |
|---|---|
| PubChem CID | 134999317 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 2,2,7,7-tetrakis(methoxymethyl)-3a-methyl-3,4,6,8-tetrahydro-1H-as-indacene |
| SMILES | COCC1(COC)CC2=CCC3(C)CC(COC)(COC)CC3=C2C1 |
| InChI | InChI=1S/C21H34O4/c1-19-7-6-16-8-20(12-22-2,13-23-3)9-17(16)18(19)10-21(11-19,14-24-4)15-25-5/h6H,7-15H2,1-5H3 |
| InChIKey | IRRZPWCHDCQWBC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |