C20H32O4 — CID 135000877
2,2,7,7-tetrakis(methoxymethyl)-1,3,3a,4,6,8-hexahydro-as-indacene (PubChem CID 135000877) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 2,2,7,7-tetrakis(methoxymethyl)-1,3,3a,4,6,8-hexahydro-as-indacene.
| Compound Name | 2,2,7,7-tetrakis(methoxymethyl)-1,3,3a,4,6,8-hexahydro-as-indacene |
|---|---|
| PubChem CID | 135000877 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 2,2,7,7-tetrakis(methoxymethyl)-1,3,3a,4,6,8-hexahydro-as-indacene |
| SMILES | COCC1(COC)CC2=CCC3CC(COC)(COC)CC3=C2C1 |
| InChI | InChI=1S/C20H32O4/c1-21-11-19(12-22-2)7-15-5-6-16-8-20(13-23-3,14-24-4)10-18(16)17(15)9-19/h5,16H,6-14H2,1-4H3 |
| InChIKey | LSDGHQFCQODMAU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |