C23H18Cl3NO4 — CID 139661100
(3-chlorophenyl)methyl 2-(2,6-dichloroanilino)-2-(2-phenylacetyl)oxyacetate (PubChem CID 139661100) has the molecular formula C23H18Cl3NO4 and a molecular weight of 478.76 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 2-(2,6-dichloroanilino)-2-(2-phenylacetyl)oxyacetate.
| Compound Name | (3-chlorophenyl)methyl 2-(2,6-dichloroanilino)-2-(2-phenylacetyl)oxyacetate |
|---|---|
| PubChem CID | 139661100 |
| Molecular Formula | C23H18Cl3NO4 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | (3-chlorophenyl)methyl 2-(2,6-dichloroanilino)-2-(2-phenylacetyl)oxyacetate |
| SMILES | O=C(Cc1ccccc1)OC(Nc1c(Cl)cccc1Cl)C(=O)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H18Cl3NO4/c24-17-9-4-8-16(12-17)14-30-23(29)22(27-21-18(25)10-5-11-19(21)26)31-20(28)13-15-6-2-1-3-7-15/h1-12,22,27H,13-14H2 |
| InChIKey | HJSWAZCINMUKKZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|