C21H21Cl2NO5 — CID 142637584
oxan-2-yl 2-(2,6-dichloroanilino)-2-(2-phenylacetyl)oxyacetate (PubChem CID 142637584) has the molecular formula C21H21Cl2NO5 and a molecular weight of 438.31 g/mol. Its IUPAC name is oxan-2-yl 2-(2,6-dichloroanilino)-2-(2-phenylacetyl)oxyacetate.
| Compound Name | oxan-2-yl 2-(2,6-dichloroanilino)-2-(2-phenylacetyl)oxyacetate |
|---|---|
| PubChem CID | 142637584 |
| Molecular Formula | C21H21Cl2NO5 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | oxan-2-yl 2-(2,6-dichloroanilino)-2-(2-phenylacetyl)oxyacetate |
| SMILES | O=C(Cc1ccccc1)OC(Nc1c(Cl)cccc1Cl)C(=O)OC1CCCCO1 |
| InChI | InChI=1S/C21H21Cl2NO5/c22-15-9-6-10-16(23)19(15)24-20(21(26)29-18-11-4-5-12-27-18)28-17(25)13-14-7-2-1-3-8-14/h1-3,6-10,18,20,24H,4-5,11-13H2 |
| InChIKey | SYYMUQJXLQIWCU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|