C20H31NO4 — CID 172828135
cyclohexanamine;oxan-2-yl (2R)-2-hydroxy-3-phenylpropanoate (PubChem CID 172828135) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is cyclohexanamine;oxan-2-yl (2R)-2-hydroxy-3-phenylpropanoate.
| Compound Name | cyclohexanamine;oxan-2-yl (2R)-2-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 172828135 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | cyclohexanamine;oxan-2-yl (2R)-2-hydroxy-3-phenylpropanoate |
| SMILES | NC1CCCCC1.O=C(OC1CCCCO1)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C14H18O4.C6H13N/c15-12(10-11-6-2-1-3-7-11)14(16)18-13-8-4-5-9-17-13;7-6-4-2-1-3-5-6/h1-3,6-7,12-13,15H,4-5,8-10H2;6H,1-5,7H2/t12-,13?;/m1./s1 |
| InChIKey | VDQGHVMZUXRMDP-QPWPOBFOSA-N |
| XLogP | 2.94 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |