C50H86O4S — CID 139661161
[(5R)-2-[(5R)-5-acetyloxy-2,5,9,13,17-pentamethyloctadeca-8,12,16-trien-2-yl]sulfanyl-2,5,9,13,17-pentamethyloctadeca-8,12,16-trien-5-yl] acetate (PubChem CID 139661161) has the molecular formula C50H86O4S and a molecular weight of 783.30 g/mol. Its IUPAC name is [(5R)-2-[(5R)-5-acetyloxy-2,5,9,13,17-pentamethyloctadeca-8,12,16-trien-2-yl]sulfanyl-2,5,9,13,17-pentamethyloctadeca-8,12,16-trien-5-yl] acetate.
| Compound Name | [(5R)-2-[(5R)-5-acetyloxy-2,5,9,13,17-pentamethyloctadeca-8,12,16-trien-2-yl]sulfanyl-2,5,9,13,17-pentamethyloctadeca-8,12,16-trien-5-yl] acetate |
|---|---|
| PubChem CID | 139661161 |
| Molecular Formula | C50H86O4S |
| Molecular Weight | 783.30 g/mol |
| Exact Mass | 782.62 |
| IUPAC Name | [(5R)-2-[(5R)-5-acetyloxy-2,5,9,13,17-pentamethyloctadeca-8,12,16-trien-2-yl]sulfanyl-2,5,9,13,17-pentamethyloctadeca-8,12,16-trien-5-yl] acetate |
| SMILES | CC(=O)O[C@](C)(CCC=C(C)CCC=C(C)CCC=C(C)C)CCC(C)(C)SC(C)(C)CC[C@@](C)(CCC=C(C)CCC=C(C)CCC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C50H86O4S/c1-39(2)23-17-25-41(5)27-19-29-43(7)31-21-33-49(15,53-45(9)51)37-35-47(11,12)55-48(13,14)36-38-50(16,54-46(10)52)34-22-32-44(8)30-20-28-42(6)26-18-24-40(3)4/h23-24,27-28,31-32H,17-22,25-26,29-30,33-38H2,1-16H3/t49-,50-/m1/s1 |
| InChIKey | NPGQVBKFSPGDSW-CDKYPKJRSA-N |
| XLogP | 15.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.30 |
| LogP ≤ 5 | 15.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|