C25H44O2S — CID 14153375
[(3R,6E,10E)-3,7,11,15-tetramethyl-1-propan-2-ylsulfanylhexadeca-6,10,14-trien-3-yl] acetate (PubChem CID 14153375) has the molecular formula C25H44O2S and a molecular weight of 408.69 g/mol. Its IUPAC name is [(3R,6E,10E)-3,7,11,15-tetramethyl-1-propan-2-ylsulfanylhexadeca-6,10,14-trien-3-yl] acetate.
| Compound Name | [(3R,6E,10E)-3,7,11,15-tetramethyl-1-propan-2-ylsulfanylhexadeca-6,10,14-trien-3-yl] acetate |
|---|---|
| PubChem CID | 14153375 |
| Molecular Formula | C25H44O2S |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | [(3R,6E,10E)-3,7,11,15-tetramethyl-1-propan-2-ylsulfanylhexadeca-6,10,14-trien-3-yl] acetate |
| SMILES | CC(=O)O[C@](C)(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CCSC(C)C |
| InChI | InChI=1S/C25H44O2S/c1-20(2)12-9-13-22(5)14-10-15-23(6)16-11-17-25(8,27-24(7)26)18-19-28-21(3)4/h12,14,16,21H,9-11,13,15,17-19H2,1-8H3/b22-14+,23-16+/t25-/m1/s1 |
| InChIKey | VXNRCKHRLUZCOA-DUANKORISA-N |
| XLogP | 8.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|