C15H28O2S — CID 14153384
(3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-3-yl) acetate (PubChem CID 14153384) has the molecular formula C15H28O2S and a molecular weight of 272.45 g/mol. Its IUPAC name is (3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-3-yl) acetate.
| Compound Name | (3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-3-yl) acetate |
|---|---|
| PubChem CID | 14153384 |
| Molecular Formula | C15H28O2S |
| Molecular Weight | 272.45 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-3-yl) acetate |
| SMILES | CC(=O)OC(C)(CCC=C(C)C)CCSC(C)C |
| InChI | InChI=1S/C15H28O2S/c1-12(2)8-7-9-15(6,17-14(5)16)10-11-18-13(3)4/h8,13H,7,9-11H2,1-6H3 |
| InChIKey | VIYRCOSSCPLLJV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|