C17H30O4S — CID 15485256
[(2S,3S)-3-acetyloxy-3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-2-yl] acetate (PubChem CID 15485256) has the molecular formula C17H30O4S and a molecular weight of 330.49 g/mol. Its IUPAC name is [(2S,3S)-3-acetyloxy-3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-2-yl] acetate.
| Compound Name | [(2S,3S)-3-acetyloxy-3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-2-yl] acetate |
|---|---|
| PubChem CID | 15485256 |
| Molecular Formula | C17H30O4S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [(2S,3S)-3-acetyloxy-3,7-dimethyl-1-propan-2-ylsulfanyloct-6-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H](CSC(C)C)[C@](C)(CCC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C17H30O4S/c1-12(2)9-8-10-17(7,21-15(6)19)16(20-14(5)18)11-22-13(3)4/h9,13,16H,8,10-11H2,1-7H3/t16-,17+/m1/s1 |
| InChIKey | BQCKIKVIWMMNAG-SJORKVTESA-N |
| XLogP | 4.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|