C30H54O4S — CID 139744552
[2-(5-acetyloxy-2,5,9-trimethyldec-8-en-2-yl)sulfanyl-2,5,9-trimethyldec-8-en-5-yl] acetate (PubChem CID 139744552) has the molecular formula C30H54O4S and a molecular weight of 510.83 g/mol. Its IUPAC name is [2-(5-acetyloxy-2,5,9-trimethyldec-8-en-2-yl)sulfanyl-2,5,9-trimethyldec-8-en-5-yl] acetate.
| Compound Name | [2-(5-acetyloxy-2,5,9-trimethyldec-8-en-2-yl)sulfanyl-2,5,9-trimethyldec-8-en-5-yl] acetate |
|---|---|
| PubChem CID | 139744552 |
| Molecular Formula | C30H54O4S |
| Molecular Weight | 510.83 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | [2-(5-acetyloxy-2,5,9-trimethyldec-8-en-2-yl)sulfanyl-2,5,9-trimethyldec-8-en-5-yl] acetate |
| SMILES | CC(=O)OC(C)(CCC=C(C)C)CCC(C)(C)SC(C)(C)CCC(C)(CCC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C30H54O4S/c1-23(2)15-13-17-29(11,33-25(5)31)21-19-27(7,8)35-28(9,10)20-22-30(12,34-26(6)32)18-14-16-24(3)4/h15-16H,13-14,17-22H2,1-12H3 |
| InChIKey | HIFKLSYTDJANIJ-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.83 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|