C19H15NO4S3 — CID 139661553
2-[2-[[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanylmethyl]phenoxy]acetic acid (PubChem CID 139661553) has the molecular formula C19H15NO4S3 and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-[2-[[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanylmethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanylmethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 139661553 |
| Molecular Formula | C19H15NO4S3 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 2-[2-[[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanylmethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1CSc1ccccc1C=C1SC(=S)NC1=O |
| InChI | InChI=1S/C19H15NO4S3/c21-17(22)10-24-14-7-3-1-6-13(14)11-26-15-8-4-2-5-12(15)9-16-18(23)20-19(25)27-16/h1-9H,10-11H2,(H,21,22)(H,20,23,25) |
| InChIKey | JYKNHGIHVVTCTH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|