C18H13NO3S3 — CID 139661591
methyl 2-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanylbenzoate (PubChem CID 139661591) has the molecular formula C18H13NO3S3 and a molecular weight of 387.51 g/mol. Its IUPAC name is methyl 2-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanylbenzoate.
| Compound Name | methyl 2-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 139661591 |
| Molecular Formula | C18H13NO3S3 |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | methyl 2-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]sulfanylbenzoate |
| SMILES | COC(=O)c1ccccc1Sc1ccccc1C=C1SC(=S)NC1=O |
| InChI | InChI=1S/C18H13NO3S3/c1-22-17(21)12-7-3-5-9-14(12)24-13-8-4-2-6-11(13)10-15-16(20)19-18(23)25-15/h2-10H,1H3,(H,19,20,23) |
| InChIKey | OIWIIVZAUXLEOG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|