C25H28N2O8 — CID 139663289
ethyl 2-[4-[2-(2-acetyloxyethyl)-4-[4-(N'-hydroxycarbamimidoyl)phenyl]-4-oxobutanoyl]phenoxy]acetate (PubChem CID 139663289) has the molecular formula C25H28N2O8 and a molecular weight of 484.51 g/mol. Its IUPAC name is ethyl 2-[4-[2-(2-acetyloxyethyl)-4-[4-(N'-hydroxycarbamimidoyl)phenyl]-4-oxobutanoyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-(2-acetyloxyethyl)-4-[4-(N'-hydroxycarbamimidoyl)phenyl]-4-oxobutanoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 139663289 |
| Molecular Formula | C25H28N2O8 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | ethyl 2-[4-[2-(2-acetyloxyethyl)-4-[4-(N'-hydroxycarbamimidoyl)phenyl]-4-oxobutanoyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C(=O)C(CCOC(C)=O)CC(=O)c2ccc(C(N)=NO)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O8/c1-3-33-23(30)15-35-21-10-8-18(9-11-21)24(31)20(12-13-34-16(2)28)14-22(29)17-4-6-19(7-5-17)25(26)27-32/h4-11,20,32H,3,12-15H2,1-2H3,(H2,26,27) |
| InChIKey | PQURJTWXFIGAOB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|