C23H17F2NO2 — CID 139663873
3-[bis(4-fluorophenyl)methyl]-1-methylindole-5-carboxylic acid (PubChem CID 139663873) has the molecular formula C23H17F2NO2 and a molecular weight of 377.39 g/mol. Its IUPAC name is 3-[bis(4-fluorophenyl)methyl]-1-methylindole-5-carboxylic acid.
| Compound Name | 3-[bis(4-fluorophenyl)methyl]-1-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 139663873 |
| Molecular Formula | C23H17F2NO2 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-[bis(4-fluorophenyl)methyl]-1-methylindole-5-carboxylic acid |
| SMILES | Cn1cc(C(c2ccc(F)cc2)c2ccc(F)cc2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C23H17F2NO2/c1-26-13-20(19-12-16(23(27)28)6-11-21(19)26)22(14-2-7-17(24)8-3-14)15-4-9-18(25)10-5-15/h2-13,22H,1H3,(H,27,28) |
| InChIKey | PJCYHSALGVTFBE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |