C22H22ClN3O4 — CID 45495031
3-[carboxy-[4-(4-chlorophenyl)piperazin-1-yl]methyl]-1-methylindole-5-carboxylic acid (PubChem CID 45495031) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is 3-[carboxy-[4-(4-chlorophenyl)piperazin-1-yl]methyl]-1-methylindole-5-carboxylic acid.
| Compound Name | 3-[carboxy-[4-(4-chlorophenyl)piperazin-1-yl]methyl]-1-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 45495031 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 3-[carboxy-[4-(4-chlorophenyl)piperazin-1-yl]methyl]-1-methylindole-5-carboxylic acid |
| SMILES | Cn1cc(C(C(=O)O)N2CCN(c3ccc(Cl)cc3)CC2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C22H22ClN3O4/c1-24-13-18(17-12-14(21(27)28)2-7-19(17)24)20(22(29)30)26-10-8-25(9-11-26)16-5-3-15(23)4-6-16/h2-7,12-13,20H,8-11H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | WYFOGMVJJGXCJQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |