C22H24N4O4 — CID 45493804
3-[carboxy-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1-methylindole-5-carboxylic acid (PubChem CID 45493804) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-[carboxy-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1-methylindole-5-carboxylic acid.
| Compound Name | 3-[carboxy-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 45493804 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[carboxy-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1-methylindole-5-carboxylic acid |
| SMILES | Cn1cc(C(C(=O)O)N2CCN(Cc3ccccn3)CC2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C22H24N4O4/c1-24-14-18(17-12-15(21(27)28)5-6-19(17)24)20(22(29)30)26-10-8-25(9-11-26)13-16-4-2-3-7-23-16/h2-7,12,14,20H,8-11,13H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | CABFWLVJSFKPGD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |